C30H17ClN2O6 — CID 86600622
benzyl 2-[3-(6-carbonochloridoyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylate (PubChem CID 86600622) has the molecular formula C30H17ClN2O6 and a molecular weight of 536.93 g/mol. Its IUPAC name is benzyl 2-[3-(6-carbonochloridoyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylate.
| Compound Name | benzyl 2-[3-(6-carbonochloridoyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylate |
|---|---|
| PubChem CID | 86600622 |
| Molecular Formula | C30H17ClN2O6 |
| Molecular Weight | 536.93 g/mol |
| Exact Mass | 536.08 |
| IUPAC Name | benzyl 2-[3-(6-carbonochloridoyl-1,3-benzoxazol-2-yl)phenyl]-1,3-dioxoisoindole-5-carboxylate |
| SMILES | O=C(Cl)c1ccc2nc(-c3cccc(N4C(=O)c5ccc(C(=O)OCc6ccccc6)cc5C4=O)c3)oc2c1 |
| InChI | InChI=1S/C30H17ClN2O6/c31-26(34)18-10-12-24-25(15-18)39-27(32-24)19-7-4-8-21(13-19)33-28(35)22-11-9-20(14-23(22)29(33)36)30(37)38-16-17-5-2-1-3-6-17/h1-15H,16H2 |
| InChIKey | JOZDMUYVHPOVBK-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 106.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.93 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|