C29H21N3O5 — CID 17362717
2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)phenyl]-6-nitrobenzo[de]isoquinoline-1,3-dione (PubChem CID 17362717) has the molecular formula C29H21N3O5 and a molecular weight of 491.50 g/mol. Its IUPAC name is 2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)phenyl]-6-nitrobenzo[de]isoquinoline-1,3-dione.
| Compound Name | 2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)phenyl]-6-nitrobenzo[de]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 17362717 |
| Molecular Formula | C29H21N3O5 |
| Molecular Weight | 491.50 g/mol |
| Exact Mass | 491.15 |
| IUPAC Name | 2-[4-(5-tert-butyl-1,3-benzoxazol-2-yl)phenyl]-6-nitrobenzo[de]isoquinoline-1,3-dione |
| SMILES | CC(C)(C)c1ccc2oc(-c3ccc(N4C(=O)c5cccc6c([N+](=O)[O-])ccc(c56)C4=O)cc3)nc2c1 |
| InChI | InChI=1S/C29H21N3O5/c1-29(2,3)17-9-14-24-22(15-17)30-26(37-24)16-7-10-18(11-8-16)31-27(33)20-6-4-5-19-23(32(35)36)13-12-21(25(19)20)28(31)34/h4-15H,1-3H3 |
| InChIKey | VLOGXEJWOUESEI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 106.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.50 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|