C27H24N2O4 — CID 17359528
5-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-(2-ethoxyphenyl)isoindole-1,3-dione (PubChem CID 17359528) has the molecular formula C27H24N2O4 and a molecular weight of 440.50 g/mol. Its IUPAC name is 5-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-(2-ethoxyphenyl)isoindole-1,3-dione.
| Compound Name | 5-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-(2-ethoxyphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 17359528 |
| Molecular Formula | C27H24N2O4 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | 5-(5-tert-butyl-1,3-benzoxazol-2-yl)-2-(2-ethoxyphenyl)isoindole-1,3-dione |
| SMILES | CCOc1ccccc1N1C(=O)c2ccc(-c3nc4cc(C(C)(C)C)ccc4o3)cc2C1=O |
| InChI | InChI=1S/C27H24N2O4/c1-5-32-23-9-7-6-8-21(23)29-25(30)18-12-10-16(14-19(18)26(29)31)24-28-20-15-17(27(2,3)4)11-13-22(20)33-24/h6-15H,5H2,1-4H3 |
| InChIKey | OITDMZZWLVOPSP-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 72.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|