C24H18N2O3 — CID 168517054
2-[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]isoindole-1,3-dione (PubChem CID 168517054) has the molecular formula C24H18N2O3 and a molecular weight of 382.42 g/mol. Its IUPAC name is 2-[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]isoindole-1,3-dione.
| Compound Name | 2-[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 168517054 |
| Molecular Formula | C24H18N2O3 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 2-[5-(5-ethyl-1,3-benzoxazol-2-yl)-2-methylphenyl]isoindole-1,3-dione |
| SMILES | CCc1ccc2oc(-c3ccc(C)c(N4C(=O)c5ccccc5C4=O)c3)nc2c1 |
| InChI | InChI=1S/C24H18N2O3/c1-3-15-9-11-21-19(12-15)25-22(29-21)16-10-8-14(2)20(13-16)26-23(27)17-6-4-5-7-18(17)24(26)28/h4-13H,3H2,1-2H3 |
| InChIKey | ZTTCITRYPPOIQJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|