C25H19BrN2O3 — CID 17359523
2-(4-bromophenyl)-5-(5-tert-butyl-1,3-benzoxazol-2-yl)isoindole-1,3-dione (PubChem CID 17359523) has the molecular formula C25H19BrN2O3 and a molecular weight of 475.34 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-(5-tert-butyl-1,3-benzoxazol-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-bromophenyl)-5-(5-tert-butyl-1,3-benzoxazol-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 17359523 |
| Molecular Formula | C25H19BrN2O3 |
| Molecular Weight | 475.34 g/mol |
| Exact Mass | 474.06 |
| IUPAC Name | 2-(4-bromophenyl)-5-(5-tert-butyl-1,3-benzoxazol-2-yl)isoindole-1,3-dione |
| SMILES | CC(C)(C)c1ccc2oc(-c3ccc4c(c3)C(=O)N(c3ccc(Br)cc3)C4=O)nc2c1 |
| InChI | InChI=1S/C25H19BrN2O3/c1-25(2,3)15-5-11-21-20(13-15)27-22(31-21)14-4-10-18-19(12-14)24(30)28(23(18)29)17-8-6-16(26)7-9-17/h4-13H,1-3H3 |
| InChIKey | UEDVDPORRXEGCT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.34 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|