C29H24N4O6 — CID 23916542
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide (PubChem CID 23916542) has the molecular formula C29H24N4O6 and a molecular weight of 524.53 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 23916542 |
| Molecular Formula | C29H24N4O6 |
| Molecular Weight | 524.53 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-cyclopentyl-3-nitrobenzamide |
| SMILES | O=C1CC(N(C(=O)c2cccc([N+](=O)[O-])c2)C2CCCC2)C(=O)N1c1ccc(-c2nc3ccccc3o2)cc1 |
| InChI | InChI=1S/C29H24N4O6/c34-26-17-24(31(20-7-1-2-8-20)28(35)19-6-5-9-22(16-19)33(37)38)29(36)32(26)21-14-12-18(13-15-21)27-30-23-10-3-4-11-25(23)39-27/h3-6,9-16,20,24H,1-2,7-8,17H2 |
| InChIKey | ACCISPWMPVYUKQ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.53 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|