C27H19ClN4O6 — CID 23972392
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-chloro-3-nitro-N-prop-2-enylbenzamide (PubChem CID 23972392) has the molecular formula C27H19ClN4O6 and a molecular weight of 530.92 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-chloro-3-nitro-N-prop-2-enylbenzamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-chloro-3-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 23972392 |
| Molecular Formula | C27H19ClN4O6 |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.10 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-4-chloro-3-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(C(=O)c1ccc(Cl)c([N+](=O)[O-])c1)C1CC(=O)N(c2ccc(-c3nc4ccccc4o3)cc2)C1=O |
| InChI | InChI=1S/C27H19ClN4O6/c1-2-13-30(26(34)17-9-12-19(28)21(14-17)32(36)37)22-15-24(33)31(27(22)35)18-10-7-16(8-11-18)25-29-20-5-3-4-6-23(20)38-25/h2-12,14,22H,1,13,15H2 |
| InChIKey | XRJVMAUQDXNTBI-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 126.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|