C22H17ClN4O8S — CID 25043373
4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-nitrobenzamide (PubChem CID 25043373) has the molecular formula C22H17ClN4O8S and a molecular weight of 532.92 g/mol. Its IUPAC name is 4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-nitrobenzamide.
| Compound Name | 4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 25043373 |
| Molecular Formula | C22H17ClN4O8S |
| Molecular Weight | 532.92 g/mol |
| Exact Mass | 532.05 |
| IUPAC Name | 4-chloro-N-[2,5-dioxo-1-(4-sulfamoylphenyl)pyrrolidin-3-yl]-N-(furan-2-ylmethyl)-3-nitrobenzamide |
| SMILES | NS(=O)(=O)c1ccc(N2C(=O)CC(N(Cc3ccco3)C(=O)c3ccc(Cl)c([N+](=O)[O-])c3)C2=O)cc1 |
| InChI | InChI=1S/C22H17ClN4O8S/c23-17-8-3-13(10-18(17)27(31)32)21(29)25(12-15-2-1-9-35-15)19-11-20(28)26(22(19)30)14-4-6-16(7-5-14)36(24,33)34/h1-10,19H,11-12H2,(H2,24,33,34) |
| InChIKey | LZVCFUGWTSEPJW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 174.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.92 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|