C29H27N3O4 — CID 23774560
N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-tert-butyl-3-methylbenzamide (PubChem CID 23774560) has the molecular formula C29H27N3O4 and a molecular weight of 481.55 g/mol. Its IUPAC name is N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-tert-butyl-3-methylbenzamide.
| Compound Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-tert-butyl-3-methylbenzamide |
|---|---|
| PubChem CID | 23774560 |
| Molecular Formula | C29H27N3O4 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | N-[1-[4-(1,3-benzoxazol-2-yl)phenyl]-2,5-dioxopyrrolidin-3-yl]-N-tert-butyl-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C2CC(=O)N(c3ccc(-c4nc5ccccc5o4)cc3)C2=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C29H27N3O4/c1-18-8-7-9-20(16-18)27(34)32(29(2,3)4)23-17-25(33)31(28(23)35)21-14-12-19(13-15-21)26-30-22-10-5-6-11-24(22)36-26/h5-16,23H,17H2,1-4H3 |
| InChIKey | IJGQUXLJCVLATD-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|