C42H25N5O6 — CID 3995493
N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 3995493) has the molecular formula C42H25N5O6 and a molecular weight of 695.69 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 3995493 |
| Molecular Formula | C42H25N5O6 |
| Molecular Weight | 695.69 g/mol |
| Exact Mass | 695.18 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-2-[4-[[4-(1,3-benzoxazol-2-yl)phenyl]carbamoyl]phenyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(N2C(=O)c3ccc(C(=O)Nc4ccc(-c5nc6ccccc6o5)cc4)cc3C2=O)cc1 |
| InChI | InChI=1S/C42H25N5O6/c48-37(43-28-16-9-25(10-17-28)39-45-33-5-1-3-7-35(33)52-39)24-13-20-30(21-14-24)47-41(50)31-22-15-27(23-32(31)42(47)51)38(49)44-29-18-11-26(12-19-29)40-46-34-6-2-4-8-36(34)53-40/h1-23H,(H,43,48)(H,44,49) |
| InChIKey | VSOWHDZRBONGPV-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 147.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.69 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|