C29H21N3O4 — CID 6737843
N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide (PubChem CID 6737843) has the molecular formula C29H21N3O4 and a molecular weight of 475.50 g/mol. Its IUPAC name is N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide.
| Compound Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide |
|---|---|
| PubChem CID | 6737843 |
| Molecular Formula | C29H21N3O4 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | N-[4-(1,3-benzoxazol-2-yl)phenyl]-4-(3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl)benzamide |
| SMILES | O=C(Nc1ccc(-c2nc3ccccc3o2)cc1)c1ccc(N2C(=O)C3C4C=CC(C4)C3C2=O)cc1 |
| InChI | InChI=1S/C29H21N3O4/c33-26(30-20-11-7-17(8-12-20)27-31-22-3-1-2-4-23(22)36-27)16-9-13-21(14-10-16)32-28(34)24-18-5-6-19(15-18)25(24)29(32)35/h1-14,18-19,24-25H,15H2,(H,30,33) |
| InChIKey | GBAMHVNDWHYNBF-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|