C21H14ClF3N2O3 — CID 126207679
N-(3-chloro-4-methylphenyl)-1-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine (PubChem CID 126207679) has the molecular formula C21H14ClF3N2O3 and a molecular weight of 434.80 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-1-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine.
| Compound Name | N-(3-chloro-4-methylphenyl)-1-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126207679 |
| Molecular Formula | C21H14ClF3N2O3 |
| Molecular Weight | 434.80 g/mol |
| Exact Mass | 434.06 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-1-[3-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
| SMILES | Cc1ccc(/N=C/c2cccc(Oc3ccc(C(F)(F)F)cc3[N+](=O)[O-])c2)cc1Cl |
| InChI | InChI=1S/C21H14ClF3N2O3/c1-13-5-7-16(11-18(13)22)26-12-14-3-2-4-17(9-14)30-20-8-6-15(21(23,24)25)10-19(20)27(28)29/h2-12H,1H3/b26-12+ |
| InChIKey | NEISKBLSVYQFTP-RPPGKUMJSA-N |
| XLogP | 7.12 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.80 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|