C23H18ClF3N2O4 — CID 126214948
N-(5-chloro-2-methylphenyl)-1-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine (PubChem CID 126214948) has the molecular formula C23H18ClF3N2O4 and a molecular weight of 478.85 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine.
| Compound Name | N-(5-chloro-2-methylphenyl)-1-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126214948 |
| Molecular Formula | C23H18ClF3N2O4 |
| Molecular Weight | 478.85 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1-[3-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
| SMILES | CCOc1cc(/C=N/c2cc(Cl)ccc2C)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H18ClF3N2O4/c1-3-32-22-10-15(13-28-18-12-17(24)7-4-14(18)2)5-8-21(22)33-20-9-6-16(23(25,26)27)11-19(20)29(30)31/h4-13H,3H2,1-2H3/b28-13+ |
| InChIKey | CXVGPGKFZHUXDQ-XODNFHPESA-N |
| XLogP | 7.52 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.85 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|