C21H13Cl2F3N2O3 — CID 126206909
N-(5-chloro-2-methylphenyl)-1-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine (PubChem CID 126206909) has the molecular formula C21H13Cl2F3N2O3 and a molecular weight of 469.25 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-1-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine.
| Compound Name | N-(5-chloro-2-methylphenyl)-1-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
|---|---|
| PubChem CID | 126206909 |
| Molecular Formula | C21H13Cl2F3N2O3 |
| Molecular Weight | 469.25 g/mol |
| Exact Mass | 468.03 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-1-[5-chloro-2-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]methanimine |
| SMILES | Cc1ccc(Cl)cc1/N=C/c1cc(Cl)ccc1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H13Cl2F3N2O3/c1-12-2-4-16(23)10-17(12)27-11-13-8-15(22)5-7-19(13)31-20-6-3-14(21(24,25)26)9-18(20)28(29)30/h2-11H,1H3/b27-11+ |
| InChIKey | JSIIBPANIPWHND-LUOAPIJWSA-N |
| XLogP | 7.77 |
| TPSA | 64.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.25 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|