C23H17Cl2F3N2O4 — CID 126206827
1-[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine (PubChem CID 126206827) has the molecular formula C23H17Cl2F3N2O4 and a molecular weight of 513.30 g/mol. Its IUPAC name is 1-[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine.
| Compound Name | 1-[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine |
|---|---|
| PubChem CID | 126206827 |
| Molecular Formula | C23H17Cl2F3N2O4 |
| Molecular Weight | 513.30 g/mol |
| Exact Mass | 512.05 |
| IUPAC Name | 1-[3-chloro-5-ethoxy-4-[2-nitro-4-(trifluoromethyl)phenoxy]phenyl]-N-(3-chloro-4-methylphenyl)methanimine |
| SMILES | CCOc1cc(/C=N/c2ccc(C)c(Cl)c2)cc(Cl)c1Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H17Cl2F3N2O4/c1-3-33-21-9-14(12-29-16-6-4-13(2)17(24)11-16)8-18(25)22(21)34-20-7-5-15(23(26,27)28)10-19(20)30(31)32/h4-12H,3H2,1-2H3/b29-12+ |
| InChIKey | IOOHTWMQMYKJDG-XKJRVUDJSA-N |
| XLogP | 8.17 |
| TPSA | 73.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.30 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|