C31H19FN2O3 — CID 2265736
[4-[(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 4-fluorobenzoate (PubChem CID 2265736) has the molecular formula C31H19FN2O3 and a molecular weight of 486.50 g/mol. Its IUPAC name is [4-[(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 4-fluorobenzoate.
| Compound Name | [4-[(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 4-fluorobenzoate |
|---|---|
| PubChem CID | 2265736 |
| Molecular Formula | C31H19FN2O3 |
| Molecular Weight | 486.50 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | [4-[(2-naphthalen-2-yl-1,3-benzoxazol-5-yl)iminomethyl]phenyl] 4-fluorobenzoate |
| SMILES | O=C(Oc1ccc(/C=N/c2ccc3oc(-c4ccc5ccccc5c4)nc3c2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C31H19FN2O3/c32-25-11-9-22(10-12-25)31(35)36-27-14-5-20(6-15-27)19-33-26-13-16-29-28(18-26)34-30(37-29)24-8-7-21-3-1-2-4-23(21)17-24/h1-19H/b33-19+ |
| InChIKey | XLAHOFMMIFBEKN-HNSNBQBZSA-N |
| XLogP | 7.76 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.50 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|