C27H15Cl2F2N3O4 — CID 135810586
2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol (PubChem CID 135810586) has the molecular formula C27H15Cl2F2N3O4 and a molecular weight of 554.34 g/mol. Its IUPAC name is 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol.
| Compound Name | 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol |
|---|---|
| PubChem CID | 135810586 |
| Molecular Formula | C27H15Cl2F2N3O4 |
| Molecular Weight | 554.34 g/mol |
| Exact Mass | 553.04 |
| IUPAC Name | 2-[[2-(2-chloro-4,5-difluorophenyl)-1,3-benzoxazol-5-yl]iminomethyl]-4-[(2-chlorophenyl)methyl]-6-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Cc2ccccc2Cl)cc(/C=N/c2ccc3oc(-c4cc(F)c(F)cc4Cl)nc3c2)c1O |
| InChI | InChI=1S/C27H15Cl2F2N3O4/c28-19-4-2-1-3-15(19)7-14-8-16(26(35)24(9-14)34(36)37)13-32-17-5-6-25-23(10-17)33-27(38-25)18-11-21(30)22(31)12-20(18)29/h1-6,8-13,35H,7H2/b32-13+ |
| InChIKey | IJAABKUEAUGSLS-JJKQSNDFSA-N |
| XLogP | 8.03 |
| TPSA | 101.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.34 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|