C14H16O3S — CID 55136258
1-(3,4-dimethoxyphenyl)-2-thiophen-2-ylethanol (PubChem CID 55136258) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-thiophen-2-ylethanol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-thiophen-2-ylethanol |
|---|---|
| PubChem CID | 55136258 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-thiophen-2-ylethanol |
| SMILES | COc1ccc(C(O)Cc2cccs2)cc1OC |
| InChI | InChI=1S/C14H16O3S/c1-16-13-6-5-10(8-14(13)17-2)12(15)9-11-4-3-7-18-11/h3-8,12,15H,9H2,1-2H3 |
| InChIKey | WUVWMHAMDOZCOS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |