C17H20N2O5S — CID 90613580
N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-(thiophen-2-ylmethyl)oxamide (PubChem CID 90613580) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-(thiophen-2-ylmethyl)oxamide.
| Compound Name | N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-(thiophen-2-ylmethyl)oxamide |
|---|---|
| PubChem CID | 90613580 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | N'-[2-(3,4-dimethoxyphenyl)-2-hydroxyethyl]-N-(thiophen-2-ylmethyl)oxamide |
| SMILES | COc1ccc(C(O)CNC(=O)C(=O)NCc2cccs2)cc1OC |
| InChI | InChI=1S/C17H20N2O5S/c1-23-14-6-5-11(8-15(14)24-2)13(20)10-19-17(22)16(21)18-9-12-4-3-7-25-12/h3-8,13,20H,9-10H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | OCXTZLZZUUZWNX-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|