C14H13Br3O2S — CID 80534250
2,3-dibromo-5-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene (PubChem CID 80534250) has the molecular formula C14H13Br3O2S and a molecular weight of 485.04 g/mol. Its IUPAC name is 2,3-dibromo-5-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene.
| Compound Name | 2,3-dibromo-5-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene |
|---|---|
| PubChem CID | 80534250 |
| Molecular Formula | C14H13Br3O2S |
| Molecular Weight | 485.04 g/mol |
| Exact Mass | 481.82 |
| IUPAC Name | 2,3-dibromo-5-[1-bromo-2-(3,4-dimethoxyphenyl)ethyl]thiophene |
| SMILES | COc1ccc(CC(Br)c2cc(Br)c(Br)s2)cc1OC |
| InChI | InChI=1S/C14H13Br3O2S/c1-18-11-4-3-8(6-12(11)19-2)5-9(15)13-7-10(16)14(17)20-13/h3-4,6-7,9H,5H2,1-2H3 |
| InChIKey | KSDXTOKGLARZHW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.04 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|