C18H21BrN2O3 — CID 55695604
1-(4-bromo-2-methylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea (PubChem CID 55695604) has the molecular formula C18H21BrN2O3 and a molecular weight of 393.28 g/mol. Its IUPAC name is 1-(4-bromo-2-methylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(4-bromo-2-methylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 55695604 |
| Molecular Formula | C18H21BrN2O3 |
| Molecular Weight | 393.28 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 1-(4-bromo-2-methylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(OC)c(C(C)NC(=O)Nc2ccc(Br)cc2C)c1 |
| InChI | InChI=1S/C18H21BrN2O3/c1-11-9-13(19)5-7-16(11)21-18(22)20-12(2)15-10-14(23-3)6-8-17(15)24-4/h5-10,12H,1-4H3,(H2,20,21,22) |
| InChIKey | KPVMURPYANGGSX-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.28 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |