C20H24N2O3 — CID 29038554
1-(2,3-dihydro-1H-inden-5-yl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea (PubChem CID 29038554) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 29038554 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]urea |
| SMILES | COc1ccc(OC)c([C@H](C)NC(=O)Nc2ccc3c(c2)CCC3)c1 |
| InChI | InChI=1S/C20H24N2O3/c1-13(18-12-17(24-2)9-10-19(18)25-3)21-20(23)22-16-8-7-14-5-4-6-15(14)11-16/h7-13H,4-6H2,1-3H3,(H2,21,22,23)/t13-/m0/s1 |
| InChIKey | BFKMACRPIPGOOE-ZDUSSCGKSA-N |
| XLogP | 4.08 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |