C21H28N2O2S — CID 2956234
1-(4-butan-2-ylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]thiourea (PubChem CID 2956234) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is 1-(4-butan-2-ylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]thiourea.
| Compound Name | 1-(4-butan-2-ylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 2956234 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | 1-(4-butan-2-ylphenyl)-3-[1-(2,5-dimethoxyphenyl)ethyl]thiourea |
| SMILES | CCC(C)c1ccc(NC(=S)NC(C)c2cc(OC)ccc2OC)cc1 |
| InChI | InChI=1S/C21H28N2O2S/c1-6-14(2)16-7-9-17(10-8-16)23-21(26)22-15(3)19-13-18(24-4)11-12-20(19)25-5/h7-15H,6H2,1-5H3,(H2,22,23,26) |
| InChIKey | GLYZPMSFLGUUDB-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|