C14H22N2O3S — CID 51390311
1-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-3-(2-methoxyethyl)thiourea (PubChem CID 51390311) has the molecular formula C14H22N2O3S and a molecular weight of 298.41 g/mol. Its IUPAC name is 1-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 51390311 |
| Molecular Formula | C14H22N2O3S |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)N[C@@H](C)c1cc(OC)ccc1OC |
| InChI | InChI=1S/C14H22N2O3S/c1-10(16-14(20)15-7-8-17-2)12-9-11(18-3)5-6-13(12)19-4/h5-6,9-10H,7-8H2,1-4H3,(H2,15,16,20)/t10-/m0/s1 |
| InChIKey | CUNMPILKGIOHFQ-JTQLQIEISA-N |
| XLogP | 1.88 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|