C21H28N2O4S — CID 100743053
1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea (PubChem CID 100743053) has the molecular formula C21H28N2O4S and a molecular weight of 404.53 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100743053 |
| Molecular Formula | C21H28N2O4S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3,4-dimethoxyphenyl)thiourea |
| SMILES | CCOc1ccc([C@@H](C)NC(=S)Nc2ccc(OC)c(OC)c2)cc1OCC |
| InChI | InChI=1S/C21H28N2O4S/c1-6-26-18-10-8-15(12-20(18)27-7-2)14(3)22-21(28)23-16-9-11-17(24-4)19(13-16)25-5/h8-14H,6-7H2,1-5H3,(H2,22,23,28)/t14-/m1/s1 |
| InChIKey | TVNOIRXJOUTVQO-CQSZACIVSA-N |
| XLogP | 4.55 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|