C21H28N2O3S — CID 100743405
1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3-ethoxyphenyl)thiourea (PubChem CID 100743405) has the molecular formula C21H28N2O3S and a molecular weight of 388.53 g/mol. Its IUPAC name is 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3-ethoxyphenyl)thiourea.
| Compound Name | 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 100743405 |
| Molecular Formula | C21H28N2O3S |
| Molecular Weight | 388.53 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | 1-[(1R)-1-(3,4-diethoxyphenyl)ethyl]-3-(3-ethoxyphenyl)thiourea |
| SMILES | CCOc1cccc(NC(=S)N[C@H](C)c2ccc(OCC)c(OCC)c2)c1 |
| InChI | InChI=1S/C21H28N2O3S/c1-5-24-18-10-8-9-17(14-18)23-21(27)22-15(4)16-11-12-19(25-6-2)20(13-16)26-7-3/h8-15H,5-7H2,1-4H3,(H2,22,23,27)/t15-/m1/s1 |
| InChIKey | SXOPPMCIRYDCRY-OAHLLOKOSA-N |
| XLogP | 4.93 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|