C19H22N2O3S — CID 100652324
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1R)-1-(4-methoxyphenyl)propyl]thiourea (PubChem CID 100652324) has the molecular formula C19H22N2O3S and a molecular weight of 358.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1R)-1-(4-methoxyphenyl)propyl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1R)-1-(4-methoxyphenyl)propyl]thiourea |
|---|---|
| PubChem CID | 100652324 |
| Molecular Formula | C19H22N2O3S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(1R)-1-(4-methoxyphenyl)propyl]thiourea |
| SMILES | CC[C@@H](NC(=S)Nc1ccc2c(c1)OCCO2)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H22N2O3S/c1-3-16(13-4-7-15(22-2)8-5-13)21-19(25)20-14-6-9-17-18(12-14)24-11-10-23-17/h4-9,12,16H,3,10-11H2,1-2H3,(H2,20,21,25)/t16-/m1/s1 |
| InChIKey | KTXRZMIRZQVROV-MRXNPFEDSA-N |
| XLogP | 3.90 |
| TPSA | 51.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|