C19H22N2O4S — CID 100580045
1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]thiourea (PubChem CID 100580045) has the molecular formula C19H22N2O4S and a molecular weight of 374.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 100580045 |
| Molecular Formula | C19H22N2O4S |
| Molecular Weight | 374.46 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-(2,3-dihydro-1,4-benzodioxin-6-yl)-3-[(2R)-1-(4-methoxyphenoxy)propan-2-yl]thiourea |
| SMILES | COc1ccc(OC[C@@H](C)NC(=S)Nc2ccc3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C19H22N2O4S/c1-13(12-25-16-6-4-15(22-2)5-7-16)20-19(26)21-14-3-8-17-18(11-14)24-10-9-23-17/h3-8,11,13H,9-10,12H2,1-2H3,(H2,20,21,26)/t13-/m1/s1 |
| InChIKey | ILUOFDWWWDAEMQ-CYBMUJFWSA-N |
| XLogP | 3.22 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|