C18H20N2O4S — CID 133217140
1-(1,3-benzodioxol-5-yl)-3-[1-(2-methoxyphenoxy)propan-2-yl]thiourea (PubChem CID 133217140) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methoxyphenoxy)propan-2-yl]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methoxyphenoxy)propan-2-yl]thiourea |
|---|---|
| PubChem CID | 133217140 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[1-(2-methoxyphenoxy)propan-2-yl]thiourea |
| SMILES | COc1ccccc1OCC(C)NC(=S)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H20N2O4S/c1-12(10-22-15-6-4-3-5-14(15)21-2)19-18(25)20-13-7-8-16-17(9-13)24-11-23-16/h3-9,12H,10-11H2,1-2H3,(H2,19,20,25) |
| InChIKey | UVLUTTCONZHGGH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|