C21H23N5O2S2 — CID 19675023
1-[1-(3,4-dimethylphenyl)ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 19675023) has the molecular formula C21H23N5O2S2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 1-[1-(3,4-dimethylphenyl)ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[1-(3,4-dimethylphenyl)ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 19675023 |
| Molecular Formula | C21H23N5O2S2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-[1-(3,4-dimethylphenyl)ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | Cc1ccc(C(C)NC(=S)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1C |
| InChI | InChI=1S/C21H23N5O2S2/c1-14-5-6-17(13-15(14)2)16(3)24-21(29)25-18-7-9-19(10-8-18)30(27,28)26-20-22-11-4-12-23-20/h4-13,16H,1-3H3,(H,22,23,26)(H2,24,25,29) |
| InChIKey | FUTMTXQLDGIUIY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|