C17H21N5O3S2 — CID 2209285
1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 2209285) has the molecular formula C17H21N5O3S2 and a molecular weight of 407.52 g/mol. Its IUPAC name is 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2209285 |
| Molecular Formula | C17H21N5O3S2 |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[(1S)-1-[(2S)-oxolan-2-yl]ethyl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | C[C@H](NC(=S)Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)[C@@H]1CCCO1 |
| InChI | InChI=1S/C17H21N5O3S2/c1-12(15-4-2-11-25-15)20-17(26)21-13-5-7-14(8-6-13)27(23,24)22-16-18-9-3-10-19-16/h3,5-10,12,15H,2,4,11H2,1H3,(H,18,19,22)(H2,20,21,26)/t12-,15-/m0/s1 |
| InChIKey | SGIFMUWXDOFORS-WFASDCNBSA-N |
| XLogP | 2.13 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|