C25H21N11O4S2 — CID 59020548
1-[1-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-1,2,4-triazol-3-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea (PubChem CID 59020548) has the molecular formula C25H21N11O4S2 and a molecular weight of 603.65 g/mol. Its IUPAC name is 1-[1-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-1,2,4-triazol-3-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-[1-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-1,2,4-triazol-3-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 59020548 |
| Molecular Formula | C25H21N11O4S2 |
| Molecular Weight | 603.65 g/mol |
| Exact Mass | 603.12 |
| IUPAC Name | 1-[1-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)-1,2,4-triazol-3-yl]-3-[4-(pyrimidin-2-ylsulfamoyl)phenyl]thiourea |
| SMILES | COc1cc2[nH]c3ncnc(-n4cnc(NC(=S)Nc5ccc(S(=O)(=O)Nc6ncccn6)cc5)n4)c3c2cc1OC |
| InChI | InChI=1S/C25H21N11O4S2/c1-39-18-10-16-17(11-19(18)40-2)32-21-20(16)22(29-12-28-21)36-13-30-24(34-36)33-25(41)31-14-4-6-15(7-5-14)42(37,38)35-23-26-8-3-9-27-23/h3-13H,1-2H3,(H,26,27,35)(H,28,29,32)(H2,31,33,34,41) |
| InChIKey | LGROWPAYIQVJPY-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 186.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.65 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|