C26H26N10O4S2 — CID 59020620
4-(2-amino-6-hydroxy-7-methoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide (PubChem CID 59020620) has the molecular formula C26H26N10O4S2 and a molecular weight of 606.69 g/mol. Its IUPAC name is 4-(2-amino-6-hydroxy-7-methoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide.
| Compound Name | 4-(2-amino-6-hydroxy-7-methoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59020620 |
| Molecular Formula | C26H26N10O4S2 |
| Molecular Weight | 606.69 g/mol |
| Exact Mass | 606.16 |
| IUPAC Name | 4-(2-amino-6-hydroxy-7-methoxy-9H-pyrimido[4,5-b]indol-4-yl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]piperazine-1-carbothioamide |
| SMILES | COc1cc2[nH]c3nc(N)nc(N4CCN(C(=S)Nc5ccc(S(=O)(=O)Nc6ncccn6)cc5)CC4)c3c2cc1O |
| InChI | InChI=1S/C26H26N10O4S2/c1-40-20-14-18-17(13-19(20)37)21-22(31-18)32-24(27)33-23(21)35-9-11-36(12-10-35)26(41)30-15-3-5-16(6-4-15)42(38,39)34-25-28-7-2-8-29-25/h2-8,13-14,37H,9-12H2,1H3,(H,30,41)(H,28,29,34)(H3,27,31,32,33) |
| InChIKey | XTRHUODURLXBKP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 187.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|