C28H31N9O4S2 — CID 173486585
N-[4-[1-[[(Z)-3-aminoprop-2-enylidene]amino]ethenylsulfamoyl]phenyl]-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide (PubChem CID 173486585) has the molecular formula C28H31N9O4S2 and a molecular weight of 621.75 g/mol. Its IUPAC name is N-[4-[1-[[(Z)-3-aminoprop-2-enylidene]amino]ethenylsulfamoyl]phenyl]-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide.
| Compound Name | N-[4-[1-[[(Z)-3-aminoprop-2-enylidene]amino]ethenylsulfamoyl]phenyl]-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 173486585 |
| Molecular Formula | C28H31N9O4S2 |
| Molecular Weight | 621.75 g/mol |
| Exact Mass | 621.19 |
| IUPAC Name | N-[4-[1-[[(Z)-3-aminoprop-2-enylidene]amino]ethenylsulfamoyl]phenyl]-4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioamide |
| SMILES | C=C(N=C/C=C\N)NS(=O)(=O)c1ccc(NC(=S)N2CCN(c3ncnc4[nH]c5cc(OC)c(OC)cc5c34)CC2)cc1 |
| InChI | InChI=1S/C28H31N9O4S2/c1-18(30-10-4-9-29)35-43(38,39)20-7-5-19(6-8-20)33-28(42)37-13-11-36(12-14-37)27-25-21-15-23(40-2)24(41-3)16-22(21)34-26(25)31-17-32-27/h4-10,15-17,35H,1,11-14,29H2,2-3H3,(H,33,42)(H,31,32,34)/b9-4-,30-10? |
| InChIKey | RZFDXLCVJCTAMN-FZXXUJMLSA-N |
| XLogP | 2.94 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.75 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|