C30H29N7O3S — CID 59020526
N-[3-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]benzamide (PubChem CID 59020526) has the molecular formula C30H29N7O3S and a molecular weight of 567.68 g/mol. Its IUPAC name is N-[3-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]benzamide.
| Compound Name | N-[3-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 59020526 |
| Molecular Formula | C30H29N7O3S |
| Molecular Weight | 567.68 g/mol |
| Exact Mass | 567.21 |
| IUPAC Name | N-[3-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)piperazine-1-carbothioyl]amino]phenyl]benzamide |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C(=S)Nc5cccc(NC(=O)c6ccccc6)c5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C30H29N7O3S/c1-39-24-16-22-23(17-25(24)40-2)35-27-26(22)28(32-18-31-27)36-11-13-37(14-12-36)30(41)34-21-10-6-9-20(15-21)33-29(38)19-7-4-3-5-8-19/h3-10,15-18H,11-14H2,1-2H3,(H,33,38)(H,34,41)(H,31,32,35) |
| InChIKey | KKECPTQCXOGVSW-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 107.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|