C17H21N5O2 — CID 14293777
6,7-dimethoxy-4-(4-methylpiperazin-1-yl)-9H-pyrimido[4,5-b]indole (PubChem CID 14293777) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)-9H-pyrimido[4,5-b]indole.
| Compound Name | 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)-9H-pyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 14293777 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 6,7-dimethoxy-4-(4-methylpiperazin-1-yl)-9H-pyrimido[4,5-b]indole |
| SMILES | COc1cc2[nH]c3ncnc(N4CCN(C)CC4)c3c2cc1OC |
| InChI | InChI=1S/C17H21N5O2/c1-21-4-6-22(7-5-21)17-15-11-8-13(23-2)14(24-3)9-12(11)20-16(15)18-10-19-17/h8-10H,4-7H2,1-3H3,(H,18,19,20) |
| InChIKey | XIELLYFNSLZEFS-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |