C21H24N8O2S2 — CID 59020601
N-[2-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]-1,3-thiazol-5-yl]-4-methylpiperazine-1-carbothioamide (PubChem CID 59020601) has the molecular formula C21H24N8O2S2 and a molecular weight of 484.61 g/mol. Its IUPAC name is N-[2-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]-1,3-thiazol-5-yl]-4-methylpiperazine-1-carbothioamide.
| Compound Name | N-[2-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]-1,3-thiazol-5-yl]-4-methylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 59020601 |
| Molecular Formula | C21H24N8O2S2 |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N-[2-[(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-4-yl)amino]-1,3-thiazol-5-yl]-4-methylpiperazine-1-carbothioamide |
| SMILES | COc1cc2[nH]c3ncnc(Nc4ncc(NC(=S)N5CCN(C)CC5)s4)c3c2cc1OC |
| InChI | InChI=1S/C21H24N8O2S2/c1-28-4-6-29(7-5-28)21(32)26-16-10-22-20(33-16)27-19-17-12-8-14(30-2)15(31-3)9-13(12)25-18(17)23-11-24-19/h8-11H,4-7H2,1-3H3,(H,26,32)(H2,22,23,24,25,27) |
| InChIKey | LDMSZRWIFLEWLY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|