C27H30N7O3S+ — CID 123638547
N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 123638547) has the molecular formula C27H30N7O3S+ and a molecular weight of 532.65 g/mol. Its IUPAC name is N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 123638547 |
| Molecular Formula | C27H30N7O3S+ |
| Molecular Weight | 532.65 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[4-[[4-(6,7-dimethoxy-9H-pyrimido[4,5-b]indol-3-ium-4-yl)piperazine-1-carbothioyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | COc1cc2[nH]c3nc[nH+]c(N4CCN(C(=S)Nc5ccc(NC(=O)C6CC6)cc5)CC4)c3c2cc1OC |
| InChI | InChI=1S/C27H29N7O3S/c1-36-21-13-19-20(14-22(21)37-2)32-24-23(19)25(29-15-28-24)33-9-11-34(12-10-33)27(38)31-18-7-5-17(6-8-18)30-26(35)16-3-4-16/h5-8,13-16H,3-4,9-12H2,1-2H3,(H,30,35)(H,31,38)(H,28,29,32)/p+1 |
| InChIKey | GTBBGSBZPDJILP-UHFFFAOYSA-O |
| XLogP | 3.41 |
| TPSA | 108.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|