C21H27N5O2 — CID 137356284
4-(azetidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-9H-pyrimido[4,5-b]indole (PubChem CID 137356284) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(azetidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-9H-pyrimido[4,5-b]indole.
| Compound Name | 4-(azetidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-9H-pyrimido[4,5-b]indole |
|---|---|
| PubChem CID | 137356284 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-(azetidin-1-yl)-6-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-9H-pyrimido[4,5-b]indole |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1)[nH]c1ncnc(N3CCC3)c12 |
| InChI | InChI=1S/C21H27N5O2/c1-27-17-12-15-16(13-18(17)28-11-5-8-25-6-2-3-7-25)24-20-19(15)21(23-14-22-20)26-9-4-10-26/h12-14H,2-11H2,1H3,(H,22,23,24) |
| InChIKey | SJAGQFPOMUUJTB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 66.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|