C23H30N4O2 — CID 137356382
8-methoxy-1-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole (PubChem CID 137356382) has the molecular formula C23H30N4O2 and a molecular weight of 394.52 g/mol. Its IUPAC name is 8-methoxy-1-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole.
| Compound Name | 8-methoxy-1-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 137356382 |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.52 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | 8-methoxy-1-pyrrolidin-1-yl-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1)[nH]c1ccnc(N3CCCC3)c12 |
| InChI | InChI=1S/C23H30N4O2/c1-28-20-15-17-19(16-21(20)29-14-6-11-26-9-2-3-10-26)25-18-7-8-24-23(22(17)18)27-12-4-5-13-27/h7-8,15-16,25H,2-6,9-14H2,1H3 |
| InChIKey | UXGMIZNZLNITDE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|