C23H32N4O3 — CID 137356287
8-methoxy-N-[(2S)-1-methoxypropan-2-yl]-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine (PubChem CID 137356287) has the molecular formula C23H32N4O3 and a molecular weight of 412.53 g/mol. Its IUPAC name is 8-methoxy-N-[(2S)-1-methoxypropan-2-yl]-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine.
| Compound Name | 8-methoxy-N-[(2S)-1-methoxypropan-2-yl]-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine |
|---|---|
| PubChem CID | 137356287 |
| Molecular Formula | C23H32N4O3 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | 8-methoxy-N-[(2S)-1-methoxypropan-2-yl]-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine |
| SMILES | COC[C@H](C)Nc1nccc2[nH]c3cc(OCCCN4CCCC4)c(OC)cc3c12 |
| InChI | InChI=1S/C23H32N4O3/c1-16(15-28-2)25-23-22-17-13-20(29-3)21(14-19(17)26-18(22)7-8-24-23)30-12-6-11-27-9-4-5-10-27/h7-8,13-14,16,26H,4-6,9-12,15H2,1-3H3,(H,24,25)/t16-/m0/s1 |
| InChIKey | RUDYVBWRKLUVMK-INIZCTEOSA-N |
| XLogP | 4.04 |
| TPSA | 71.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|