C23H30N4O3 — CID 137356473
(3S)-1-[8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-yl]pyrrolidin-3-ol (PubChem CID 137356473) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is (3S)-1-[8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-yl]pyrrolidin-3-ol.
| Compound Name | (3S)-1-[8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-yl]pyrrolidin-3-ol |
|---|---|
| PubChem CID | 137356473 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (3S)-1-[8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-yl]pyrrolidin-3-ol |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1)[nH]c1ccnc(N3CC[C@H](O)C3)c12 |
| InChI | InChI=1S/C23H30N4O3/c1-29-20-13-17-19(14-21(20)30-12-4-10-26-8-2-3-9-26)25-18-5-7-24-23(22(17)18)27-11-6-16(28)15-27/h5,7,13-14,16,25,28H,2-4,6,8-12,15H2,1H3/t16-/m0/s1 |
| InChIKey | ZWEGXAGBPRETJW-INIZCTEOSA-N |
| XLogP | 3.16 |
| TPSA | 73.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|