C23H29N3O2 — CID 137356773
1-cyclopropyl-8-methoxy-7-[3-(2-methylpyrrolidin-1-yl)propoxy]-5H-pyrido[4,3-b]indole (PubChem CID 137356773) has the molecular formula C23H29N3O2 and a molecular weight of 379.50 g/mol. Its IUPAC name is 1-cyclopropyl-8-methoxy-7-[3-(2-methylpyrrolidin-1-yl)propoxy]-5H-pyrido[4,3-b]indole.
| Compound Name | 1-cyclopropyl-8-methoxy-7-[3-(2-methylpyrrolidin-1-yl)propoxy]-5H-pyrido[4,3-b]indole |
|---|---|
| PubChem CID | 137356773 |
| Molecular Formula | C23H29N3O2 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | 1-cyclopropyl-8-methoxy-7-[3-(2-methylpyrrolidin-1-yl)propoxy]-5H-pyrido[4,3-b]indole |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1C)[nH]c1ccnc(C3CC3)c12 |
| InChI | InChI=1S/C23H29N3O2/c1-15-5-3-10-26(15)11-4-12-28-21-14-19-17(13-20(21)27-2)22-18(25-19)8-9-24-23(22)16-6-7-16/h8-9,13-16,25H,3-7,10-12H2,1-2H3 |
| InChIKey | SPMYJNXENSICSS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|