C23H32N4O2 — CID 137356420
N,N-diethyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine (PubChem CID 137356420) has the molecular formula C23H32N4O2 and a molecular weight of 396.54 g/mol. Its IUPAC name is N,N-diethyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine.
| Compound Name | N,N-diethyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine |
|---|---|
| PubChem CID | 137356420 |
| Molecular Formula | C23H32N4O2 |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.25 |
| IUPAC Name | N,N-diethyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indol-1-amine |
| SMILES | CCN(CC)c1nccc2[nH]c3cc(OCCCN4CCCC4)c(OC)cc3c12 |
| InChI | InChI=1S/C23H32N4O2/c1-4-27(5-2)23-22-17-15-20(28-3)21(16-19(17)25-18(22)9-10-24-23)29-14-8-13-26-11-6-7-12-26/h9-10,15-16,25H,4-8,11-14H2,1-3H3 |
| InChIKey | LKFSKLNALVFBKI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 53.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|