C22H28ClN3O2 — CID 137356805
3-cyclopropyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole;hydrochloride (PubChem CID 137356805) has the molecular formula C22H28ClN3O2 and a molecular weight of 401.94 g/mol. Its IUPAC name is 3-cyclopropyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole;hydrochloride.
| Compound Name | 3-cyclopropyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole;hydrochloride |
|---|---|
| PubChem CID | 137356805 |
| Molecular Formula | C22H28ClN3O2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 3-cyclopropyl-8-methoxy-7-(3-pyrrolidin-1-ylpropoxy)-5H-pyrido[4,3-b]indole;hydrochloride |
| SMILES | COc1cc2c(cc1OCCCN1CCCC1)[nH]c1cc(C3CC3)ncc12.Cl |
| InChI | InChI=1S/C22H27N3O2.ClH/c1-26-21-11-16-17-14-23-18(15-5-6-15)12-19(17)24-20(16)13-22(21)27-10-4-9-25-7-2-3-8-25;/h11-15,24H,2-10H2,1H3;1H |
| InChIKey | WPFIQCOHPBVKBA-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|