C21H22N6O3 — CID 90395621
4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9H-pyrimido[4,5-b]indol-4-yl]piperazine-1-carbaldehyde (PubChem CID 90395621) has the molecular formula C21H22N6O3 and a molecular weight of 406.45 g/mol. Its IUPAC name is 4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9H-pyrimido[4,5-b]indol-4-yl]piperazine-1-carbaldehyde.
| Compound Name | 4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9H-pyrimido[4,5-b]indol-4-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 90395621 |
| Molecular Formula | C21H22N6O3 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.18 |
| IUPAC Name | 4-[7-(3,5-dimethyl-1,2-oxazol-4-yl)-6-methoxy-9H-pyrimido[4,5-b]indol-4-yl]piperazine-1-carbaldehyde |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1ncnc(N3CCN(C=O)CC3)c12 |
| InChI | InChI=1S/C21H22N6O3/c1-12-18(13(2)30-25-12)15-8-16-14(9-17(15)29-3)19-20(24-16)22-10-23-21(19)27-6-4-26(11-28)5-7-27/h8-11H,4-7H2,1-3H3,(H,22,23,24) |
| InChIKey | RQPIUARIYGOJCK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 100.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|