C16H15N5O3S2 — CID 71466748
1-[4-[(5-oxo-1,4-dihydroimidazol-2-yl)sulfamoyl]phenyl]-3-phenylthiourea (PubChem CID 71466748) has the molecular formula C16H15N5O3S2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 1-[4-[(5-oxo-1,4-dihydroimidazol-2-yl)sulfamoyl]phenyl]-3-phenylthiourea.
| Compound Name | 1-[4-[(5-oxo-1,4-dihydroimidazol-2-yl)sulfamoyl]phenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 71466748 |
| Molecular Formula | C16H15N5O3S2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 1-[4-[(5-oxo-1,4-dihydroimidazol-2-yl)sulfamoyl]phenyl]-3-phenylthiourea |
| SMILES | O=C1CN=C(NS(=O)(=O)c2ccc(NC(=S)Nc3ccccc3)cc2)N1 |
| InChI | InChI=1S/C16H15N5O3S2/c22-14-10-17-15(20-14)21-26(23,24)13-8-6-12(7-9-13)19-16(25)18-11-4-2-1-3-5-11/h1-9H,10H2,(H2,18,19,25)(H2,17,20,21,22) |
| InChIKey | DXPMAQNBMBUWFN-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 111.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|