C31H28N2O5S2 — CID 101387780
1,3-bis[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-phenylpropan-1-one (PubChem CID 101387780) has the molecular formula C31H28N2O5S2 and a molecular weight of 572.71 g/mol. Its IUPAC name is 1,3-bis[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-phenylpropan-1-one.
| Compound Name | 1,3-bis[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-phenylpropan-1-one |
|---|---|
| PubChem CID | 101387780 |
| Molecular Formula | C31H28N2O5S2 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.14 |
| IUPAC Name | 1,3-bis[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-3-phenylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2cccc2C(=O)CC(c2ccccc2)c2cccn2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H28N2O5S2/c1-23-12-16-26(17-13-23)39(35,36)32-20-6-10-29(32)28(25-8-4-3-5-9-25)22-31(34)30-11-7-21-33(30)40(37,38)27-18-14-24(2)15-19-27/h3-21,28H,22H2,1-2H3 |
| InChIKey | URAULFKOHKPMMM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 95.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |