C20H23NO6S — CID 150312430
1-[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-4-(oxan-2-yloxy)butane-1,3-dione (PubChem CID 150312430) has the molecular formula C20H23NO6S and a molecular weight of 405.47 g/mol. Its IUPAC name is 1-[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-4-(oxan-2-yloxy)butane-1,3-dione.
| Compound Name | 1-[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-4-(oxan-2-yloxy)butane-1,3-dione |
|---|---|
| PubChem CID | 150312430 |
| Molecular Formula | C20H23NO6S |
| Molecular Weight | 405.47 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 1-[1-(4-methylphenyl)sulfonylpyrrol-2-yl]-4-(oxan-2-yloxy)butane-1,3-dione |
| SMILES | Cc1ccc(S(=O)(=O)n2cccc2C(=O)CC(=O)COC2CCCCO2)cc1 |
| InChI | InChI=1S/C20H23NO6S/c1-15-7-9-17(10-8-15)28(24,25)21-11-4-5-18(21)19(23)13-16(22)14-27-20-6-2-3-12-26-20/h4-5,7-11,20H,2-3,6,12-14H2,1H3 |
| InChIKey | GLXHTANZMAJFPE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|