C14H16BrNO2S2 — CID 13167603
2-(3-bromopropylsulfanyl)-1-(4-methylphenyl)sulfonylpyrrole (PubChem CID 13167603) has the molecular formula C14H16BrNO2S2 and a molecular weight of 374.33 g/mol. Its IUPAC name is 2-(3-bromopropylsulfanyl)-1-(4-methylphenyl)sulfonylpyrrole.
| Compound Name | 2-(3-bromopropylsulfanyl)-1-(4-methylphenyl)sulfonylpyrrole |
|---|---|
| PubChem CID | 13167603 |
| Molecular Formula | C14H16BrNO2S2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 372.98 |
| IUPAC Name | 2-(3-bromopropylsulfanyl)-1-(4-methylphenyl)sulfonylpyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2cccc2SCCCBr)cc1 |
| InChI | InChI=1S/C14H16BrNO2S2/c1-12-5-7-13(8-6-12)20(17,18)16-10-2-4-14(16)19-11-3-9-15/h2,4-8,10H,3,9,11H2,1H3 |
| InChIKey | QTYJWTVILJTYDZ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|